C6H8N4O4 — CID 142956580
3,6-dioxo-5,7,8,8a-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrazine-1-carboxylic acid (PubChem CID 142956580) has the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. Its IUPAC name is 3,6-dioxo-5,7,8,8a-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrazine-1-carboxylic acid.
| Compound Name | 3,6-dioxo-5,7,8,8a-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrazine-1-carboxylic acid |
|---|---|
| PubChem CID | 142956580 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 3,6-dioxo-5,7,8,8a-tetrahydro-2H-[1,2,4]triazolo[4,3-a]pyrazine-1-carboxylic acid |
| SMILES | O=C1CN2C(=O)NN(C(=O)O)C2CN1 |
| InChI | InChI=1S/C6H8N4O4/c11-3-2-9-4(1-7-3)10(6(13)14)8-5(9)12/h4H,1-2H2,(H,7,11)(H,8,12)(H,13,14) |
| InChIKey | LYWWENWOFCNHIR-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |