C28H43FO2 — CID 142957279
fluoro (4R)-4-(3-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 142957279) has the molecular formula C28H43FO2 and a molecular weight of 430.65 g/mol. Its IUPAC name is fluoro (4R)-4-(3-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | fluoro (4R)-4-(3-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 142957279 |
| Molecular Formula | C28H43FO2 |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | fluoro (4R)-4-(3-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CC=C(C)C1CCC2(C)C(=CCC3C2CCC2(C)C3CCC2[C@H](C)CCC(=O)OF)C1 |
| InChI | InChI=1S/C28H43FO2/c1-6-18(2)20-13-15-27(4)21(17-20)8-9-22-24-11-10-23(19(3)7-12-26(30)31-29)28(24,5)16-14-25(22)27/h6,8,19-20,22-25H,7,9-17H2,1-5H3/t19-,20?,22?,23?,24?,25?,27?,28?/m1/s1 |
| InChIKey | VOZFGAKLTXVFLT-LHGORIIGSA-N |
| XLogP | 7.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|