C24H37NO3 — CID 163520742
(4R)-4-[(3R,10R,13R,17R)-10,13-dimethyl-3-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 163520742) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is (4R)-4-[(3R,10R,13R,17R)-10,13-dimethyl-3-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3R,10R,13R,17R)-10,13-dimethyl-3-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 163520742 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | (4R)-4-[(3R,10R,13R,17R)-10,13-dimethyl-3-nitroso-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CCC2C3CC=C4C[C@H](N=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C24H37NO3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25-28)10-12-23(16,2)21(18)11-13-24(19,20)3/h5,15,17-21H,4,6-14H2,1-3H3,(H,26,27)/t15-,17-,18?,19-,20?,21?,23+,24-/m1/s1 |
| InChIKey | DKOSYIPBRCIKSV-CBXUJCOHSA-N |
| XLogP | 6.20 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|