About (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione
(Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione (PubChem CID 142957854) has the molecular formula C19H22O2S
and a molecular weight of 314.45 g/mol. Its IUPAC name is (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione.
Molecular Properties
| Compound Name | (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione |
| PubChem CID | 142957854 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione |
| SMILES | CC(=O)/C(C)=C\c1ccc(-c2ccc(C)cc2)o1.CC(C)=S |
| InChI | InChI=1S/C16H16O2.C3H6S/c1-11-4-6-14(7-5-11)16-9-8-15(18-16)10-12(2)13(3)17;1-3(2)4/h4-10H,1-3H3;1-2H3/b12-10-; |
| InChIKey | ZADAOIINDIKBAU-BBJSDXRSSA-N |
| XLogP | 5.64 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione?
The IUPAC name of (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione (CID 142957854) is (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione.
What is the SMILES notation for (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione?
The canonical SMILES for (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione is CC(=O)/C(C)=C\c1ccc(-c2ccc(C)cc2)o1.CC(C)=S.
What is the InChIKey of (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione?
The InChIKey is ZADAOIINDIKBAU-BBJSDXRSSA-N. The full InChI is InChI=1S/C16H16O2.C3H6S/c1-11-4-6-14(7-5-11)16-9-8-15(18-16)10-12(2)13(3)17;1-3(2)4/h4-10H,1-3H3;1-2H3/b12-10-;.
What are the key properties of (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione?
(Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione has a molecular weight of 314.45 g/mol, XLogP of 5.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methyl-4-[5-(4-methylphenyl)furan-2-yl]but-3-en-2-one;propane-2-thione is sourced from PubChem (CID 142957854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).