C20H21NO3S — CID 145018517
(E)-N-ethanethioyl-N-(2-hydroxyprop-2-enyl)-2-methyl-3-[5-(4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 145018517) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is (E)-N-ethanethioyl-N-(2-hydroxyprop-2-enyl)-2-methyl-3-[5-(4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-ethanethioyl-N-(2-hydroxyprop-2-enyl)-2-methyl-3-[5-(4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 145018517 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (E)-N-ethanethioyl-N-(2-hydroxyprop-2-enyl)-2-methyl-3-[5-(4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | C=C(O)CN(C(=O)/C(C)=C/c1ccc(-c2ccc(C)cc2)o1)C(C)=S |
| InChI | InChI=1S/C20H21NO3S/c1-13-5-7-17(8-6-13)19-10-9-18(24-19)11-14(2)20(23)21(16(4)25)12-15(3)22/h5-11,22H,3,12H2,1-2,4H3/b14-11+ |
| InChIKey | RVYKHEGAVIQMQO-SDNWHVSQSA-N |
| XLogP | 4.91 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|