C22H22N6O2 — CID 142957949
3-[(3Z)-penta-1,3-dien-2-yl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole;N-[(E)-prop-1-enyl]furan-2-carboxamide (PubChem CID 142957949) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-[(3Z)-penta-1,3-dien-2-yl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole;N-[(E)-prop-1-enyl]furan-2-carboxamide.
| Compound Name | 3-[(3Z)-penta-1,3-dien-2-yl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole;N-[(E)-prop-1-enyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 142957949 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-[(3Z)-penta-1,3-dien-2-yl]-5-(1H-1,2,4-triazol-5-yl)-1H-indazole;N-[(E)-prop-1-enyl]furan-2-carboxamide |
| SMILES | C/C=C/NC(=O)c1ccco1.C=C(/C=C\C)c1n[nH]c2ccc(-c3ncn[nH]3)cc12 |
| InChI | InChI=1S/C14H13N5.C8H9NO2/c1-3-4-9(2)13-11-7-10(14-15-8-16-19-14)5-6-12(11)17-18-13;1-2-5-9-8(10)7-4-3-6-11-7/h3-8H,2H2,1H3,(H,17,18)(H,15,16,19);2-6H,1H3,(H,9,10)/b4-3-;5-2+ |
| InChIKey | KYYJCRKCUDDRFM-SPKQNFTRSA-N |
| XLogP | 4.48 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|