C23H22N6O — CID 142958001
(Z,2E)-N-benzyl-2-[2-[5-(1H-1,2,4-triazol-5-yl)-2H-indazol-3-yl]ethylidene]pent-3-enamide (PubChem CID 142958001) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is (Z,2E)-N-benzyl-2-[2-[5-(1H-1,2,4-triazol-5-yl)-2H-indazol-3-yl]ethylidene]pent-3-enamide.
| Compound Name | (Z,2E)-N-benzyl-2-[2-[5-(1H-1,2,4-triazol-5-yl)-2H-indazol-3-yl]ethylidene]pent-3-enamide |
|---|---|
| PubChem CID | 142958001 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (Z,2E)-N-benzyl-2-[2-[5-(1H-1,2,4-triazol-5-yl)-2H-indazol-3-yl]ethylidene]pent-3-enamide |
| SMILES | C/C=C\C(=C/Cc1[nH]nc2ccc(-c3ncn[nH]3)cc12)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H22N6O/c1-2-6-17(23(30)24-14-16-7-4-3-5-8-16)9-11-20-19-13-18(22-25-15-26-29-22)10-12-21(19)28-27-20/h2-10,12-13,15H,11,14H2,1H3,(H,24,30)(H,27,28)(H,25,26,29)/b6-2-,17-9+ |
| InChIKey | BZTOZIUGZCOAFG-WLNKLCLLSA-N |
| XLogP | 3.71 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|