C24H30N2O2 — CID 142917001
(3E,5Z)-N-benzyl-2-methylidene-5-[[(E)-1-oxohex-2-en-3-yl]amino]-4-[(Z)-prop-1-enyl]hepta-3,5-dienamide (PubChem CID 142917001) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (3E,5Z)-N-benzyl-2-methylidene-5-[[(E)-1-oxohex-2-en-3-yl]amino]-4-[(Z)-prop-1-enyl]hepta-3,5-dienamide.
| Compound Name | (3E,5Z)-N-benzyl-2-methylidene-5-[[(E)-1-oxohex-2-en-3-yl]amino]-4-[(Z)-prop-1-enyl]hepta-3,5-dienamide |
|---|---|
| PubChem CID | 142917001 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (3E,5Z)-N-benzyl-2-methylidene-5-[[(E)-1-oxohex-2-en-3-yl]amino]-4-[(Z)-prop-1-enyl]hepta-3,5-dienamide |
| SMILES | C=C(/C=C(\C=C/C)C(=C/C)/N/C(=C/C=O)CCC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O2/c1-5-11-21(23(7-3)26-22(12-6-2)15-16-27)17-19(4)24(28)25-18-20-13-9-8-10-14-20/h5,7-11,13-17,26H,4,6,12,18H2,1-3H3,(H,25,28)/b11-5-,21-17+,22-15+,23-7- |
| InChIKey | XVDORHAOOXTUPG-OFTCWYPLSA-N |
| XLogP | 4.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|