C18H20N6 — CID 142958037
(3E,6Z)-N-methyl-2-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]octa-1,3,6-trien-4-amine (PubChem CID 142958037) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is (3E,6Z)-N-methyl-2-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]octa-1,3,6-trien-4-amine.
| Compound Name | (3E,6Z)-N-methyl-2-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]octa-1,3,6-trien-4-amine |
|---|---|
| PubChem CID | 142958037 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3E,6Z)-N-methyl-2-[5-(1H-1,2,4-triazol-5-yl)-1H-indazol-3-yl]octa-1,3,6-trien-4-amine |
| SMILES | C=C(/C=C(\C/C=C\C)NC)c1n[nH]c2ccc(-c3ncn[nH]3)cc12 |
| InChI | InChI=1S/C18H20N6/c1-4-5-6-14(19-3)9-12(2)17-15-10-13(18-20-11-21-24-18)7-8-16(15)22-23-17/h4-5,7-11,19H,2,6H2,1,3H3,(H,22,23)(H,20,21,24)/b5-4-,14-9+ |
| InChIKey | WEERGPKXSVZWGA-NAJRDQDTSA-N |
| XLogP | 3.43 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|