C16H17ClF2N2O — CID 142959891
N-[(2-chloro-3,6-difluorophenyl)methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-3-carboxamide (PubChem CID 142959891) has the molecular formula C16H17ClF2N2O and a molecular weight of 326.77 g/mol. Its IUPAC name is N-[(2-chloro-3,6-difluorophenyl)methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-3-carboxamide.
| Compound Name | N-[(2-chloro-3,6-difluorophenyl)methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 142959891 |
| Molecular Formula | C16H17ClF2N2O |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(2-chloro-3,6-difluorophenyl)methyl]-N-cyclopropyl-1,2,3,6-tetrahydropyridine-3-carboxamide |
| SMILES | O=C(C1C=CCNC1)N(Cc1c(F)ccc(F)c1Cl)C1CC1 |
| InChI | InChI=1S/C16H17ClF2N2O/c17-15-12(13(18)5-6-14(15)19)9-21(11-3-4-11)16(22)10-2-1-7-20-8-10/h1-2,5-6,10-11,20H,3-4,7-9H2 |
| InChIKey | ZVBZTJJNRQIXOR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|