C16H15Cl2NO3 — CID 154872069
(1R,4S)-4-[cyclopropyl-[(2,6-dichlorophenyl)methyl]carbamoyl]cyclobut-2-ene-1-carboxylic acid (PubChem CID 154872069) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is (1R,4S)-4-[cyclopropyl-[(2,6-dichlorophenyl)methyl]carbamoyl]cyclobut-2-ene-1-carboxylic acid.
| Compound Name | (1R,4S)-4-[cyclopropyl-[(2,6-dichlorophenyl)methyl]carbamoyl]cyclobut-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 154872069 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (1R,4S)-4-[cyclopropyl-[(2,6-dichlorophenyl)methyl]carbamoyl]cyclobut-2-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C=C[C@@H]1C(=O)N(Cc1c(Cl)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C16H15Cl2NO3/c17-13-2-1-3-14(18)12(13)8-19(9-4-5-9)15(20)10-6-7-11(10)16(21)22/h1-3,6-7,9-11H,4-5,8H2,(H,21,22)/t10-,11+/m0/s1 |
| InChIKey | VPYMRCDMNQOGEZ-WDEREUQCSA-N |
| XLogP | 3.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|