C27H42N4O3 — CID 142961831
ethane;N-formyl-N-[4-[[N-[(Z)-2-[(Z)-1-methoxyethenyliminomethyl]pent-2-enyl]-C-methylcarbonimidoyl]-methylamino]butyl]-2-methylbenzamide (PubChem CID 142961831) has the molecular formula C27H42N4O3 and a molecular weight of 470.66 g/mol. Its IUPAC name is ethane;N-formyl-N-[4-[[N-[(Z)-2-[(Z)-1-methoxyethenyliminomethyl]pent-2-enyl]-C-methylcarbonimidoyl]-methylamino]butyl]-2-methylbenzamide.
| Compound Name | ethane;N-formyl-N-[4-[[N-[(Z)-2-[(Z)-1-methoxyethenyliminomethyl]pent-2-enyl]-C-methylcarbonimidoyl]-methylamino]butyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 142961831 |
| Molecular Formula | C27H42N4O3 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | ethane;N-formyl-N-[4-[[N-[(Z)-2-[(Z)-1-methoxyethenyliminomethyl]pent-2-enyl]-C-methylcarbonimidoyl]-methylamino]butyl]-2-methylbenzamide |
| SMILES | C=C(/N=C\C(=C/CC)C/N=C(\C)N(C)CCCCN(C=O)C(=O)c1ccccc1C)OC.CC |
| InChI | InChI=1S/C25H36N4O3.C2H6/c1-7-12-23(18-27-22(4)32-6)17-26-21(3)28(5)15-10-11-16-29(19-30)25(31)24-14-9-8-13-20(24)2;1-2/h8-9,12-14,18-19H,4,7,10-11,15-17H2,1-3,5-6H3;1-2H3/b23-12-,26-21+,27-18-; |
| InChIKey | MVWXDBZHXPTBRJ-VKKWAUBHSA-N |
| XLogP | 5.28 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|