C22H26N2O3S — CID 143191201
S-[4-[4-[formyl-(2-methylbenzoyl)amino]butyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 143191201) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is S-[4-[4-[formyl-(2-methylbenzoyl)amino]butyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[4-[formyl-(2-methylbenzoyl)amino]butyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 143191201 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | S-[4-[4-[formyl-(2-methylbenzoyl)amino]butyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1ccccc1C(=O)N(C=O)CCCCc1ccc(SC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O3S/c1-17-8-4-5-10-20(17)21(26)24(16-25)15-7-6-9-18-11-13-19(14-12-18)28-22(27)23(2)3/h4-5,8,10-14,16H,6-7,9,15H2,1-3H3 |
| InChIKey | PBGQJPACLXHNLM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|