C23H30N4O2 — CID 142962100
N-[4-[(5,6-dimethyl-3-pyridinyl)methyliminomethyl-methylamino]butyl]-N-formyl-2-methylbenzamide (PubChem CID 142962100) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4-[(5,6-dimethyl-3-pyridinyl)methyliminomethyl-methylamino]butyl]-N-formyl-2-methylbenzamide.
| Compound Name | N-[4-[(5,6-dimethyl-3-pyridinyl)methyliminomethyl-methylamino]butyl]-N-formyl-2-methylbenzamide |
|---|---|
| PubChem CID | 142962100 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[4-[(5,6-dimethyl-3-pyridinyl)methyliminomethyl-methylamino]butyl]-N-formyl-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C=O)CCCCN(C)/C=N/Cc1cnc(C)c(C)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-18-9-5-6-10-22(18)23(29)27(17-28)12-8-7-11-26(4)16-24-14-21-13-19(2)20(3)25-15-21/h5-6,9-10,13,15-17H,7-8,11-12,14H2,1-4H3/b24-16+ |
| InChIKey | HHUDLZPONFNXJP-LFVJCYFKSA-N |
| XLogP | 3.55 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|