C26H34N4O3 — CID 142962080
acetylene;N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-N'-[(6-methoxy-3-pyridinyl)methyl]methanimidamide;ethane (PubChem CID 142962080) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is acetylene;N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-N'-[(6-methoxy-3-pyridinyl)methyl]methanimidamide;ethane.
| Compound Name | acetylene;N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-N'-[(6-methoxy-3-pyridinyl)methyl]methanimidamide;ethane |
|---|---|
| PubChem CID | 142962080 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | acetylene;N-[4-(1,3-dioxoisoindol-2-yl)butyl]-N-ethyl-N'-[(6-methoxy-3-pyridinyl)methyl]methanimidamide;ethane |
| SMILES | C#C.CC.CCN(/C=N/Cc1ccc(OC)nc1)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H26N4O3.C2H6.C2H2/c1-3-25(16-23-14-17-10-11-20(29-2)24-15-17)12-6-7-13-26-21(27)18-8-4-5-9-19(18)22(26)28;2*1-2/h4-5,8-11,15-16H,3,6-7,12-14H2,1-2H3;1-2H3;1-2H/b23-16+;; |
| InChIKey | BGTXGZQFLQITCH-CGSMVWNQSA-N |
| XLogP | 4.29 |
| TPSA | 75.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|