C22H31NO7 — CID 142962710
2-morpholin-4-ylethyl (E)-6-[3-formyl-2,6-dihydroxy-4-(hydroxymethyl)-5-methylphenyl]-4-methylhex-4-enoate (PubChem CID 142962710) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl (E)-6-[3-formyl-2,6-dihydroxy-4-(hydroxymethyl)-5-methylphenyl]-4-methylhex-4-enoate.
| Compound Name | 2-morpholin-4-ylethyl (E)-6-[3-formyl-2,6-dihydroxy-4-(hydroxymethyl)-5-methylphenyl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 142962710 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-morpholin-4-ylethyl (E)-6-[3-formyl-2,6-dihydroxy-4-(hydroxymethyl)-5-methylphenyl]-4-methylhex-4-enoate |
| SMILES | C/C(=C\Cc1c(O)c(C)c(CO)c(C=O)c1O)CCC(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C22H31NO7/c1-15(4-6-20(26)30-12-9-23-7-10-29-11-8-23)3-5-17-21(27)16(2)18(13-24)19(14-25)22(17)28/h3,14,24,27-28H,4-13H2,1-2H3/b15-3+ |
| InChIKey | MSBXLUNSYOXGQB-CRKCGEKBSA-N |
| XLogP | 1.86 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|