C23H33NO6 — CID 142968553
2-morpholin-4-ylethyl (E)-6-[5-formyl-4-(hydroxymethyl)-2-methoxy-3-methylphenyl]-4-methylhex-4-enoate (PubChem CID 142968553) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl (E)-6-[5-formyl-4-(hydroxymethyl)-2-methoxy-3-methylphenyl]-4-methylhex-4-enoate.
| Compound Name | 2-morpholin-4-ylethyl (E)-6-[5-formyl-4-(hydroxymethyl)-2-methoxy-3-methylphenyl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 142968553 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-morpholin-4-ylethyl (E)-6-[5-formyl-4-(hydroxymethyl)-2-methoxy-3-methylphenyl]-4-methylhex-4-enoate |
| SMILES | COc1c(C/C=C(\C)CCC(=O)OCCN2CCOCC2)cc(C=O)c(CO)c1C |
| InChI | InChI=1S/C23H33NO6/c1-17(5-7-22(27)30-13-10-24-8-11-29-12-9-24)4-6-19-14-20(15-25)21(16-26)18(2)23(19)28-3/h4,14-15,26H,5-13,16H2,1-3H3/b17-4+ |
| InChIKey | PJRONSZZSPORHJ-HAVNEIBRSA-N |
| XLogP | 2.45 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|