C14H20N2 — CID 142965606
3,6-dimethyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine (PubChem CID 142965606) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3,6-dimethyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine.
| Compound Name | 3,6-dimethyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 142965606 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3,6-dimethyl-2-[(1Z,3Z)-penta-1,3-dienyl]-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridine |
| SMILES | C/C=C\C=C/c1[nH]c2c(c1C)CCN(C)C2 |
| InChI | InChI=1S/C14H20N2/c1-4-5-6-7-13-11(2)12-8-9-16(3)10-14(12)15-13/h4-7,15H,8-10H2,1-3H3/b5-4-,7-6- |
| InChIKey | KACDIGLJRMLMBK-RZSVFLSASA-N |
| XLogP | 2.90 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|