C10H15NO — CID 142966319
4,7-dimethyl-2,3,5,6-tetrahydro-1,4-benzoxazine (PubChem CID 142966319) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4,7-dimethyl-2,3,5,6-tetrahydro-1,4-benzoxazine.
| Compound Name | 4,7-dimethyl-2,3,5,6-tetrahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 142966319 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4,7-dimethyl-2,3,5,6-tetrahydro-1,4-benzoxazine |
| SMILES | CC1=CC2=C(CC1)N(C)CCO2 |
| InChI | InChI=1S/C10H15NO/c1-8-3-4-9-10(7-8)12-6-5-11(9)2/h7H,3-6H2,1-2H3 |
| InChIKey | VEYBBGNAPWIGGP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |