About ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine
ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine (PubChem CID 143176155) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine.
Analyze ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine?
The IUPAC name of ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine (CID 143176155) is ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine.
What is the SMILES notation for ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine?
The canonical SMILES for ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine is CC.CC1=CC2=C(CC1)NCCO2.
What is the InChIKey of ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine?
The InChIKey is JAKQDGJNZREJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.C2H6/c1-7-2-3-8-9(6-7)11-5-4-10-8;1-2/h6,10H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine?
ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine has a molecular weight of 181.28 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-3,4,5,6-tetrahydro-2H-1,4-benzoxazine is sourced from PubChem (CID 143176155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).