C29H32FN3OS — CID 142966947
N,N-diethyl-4-[[2-[(2-fluorophenyl)sulfanylamino]phenyl]-piperidin-4-ylidenemethyl]benzamide (PubChem CID 142966947) has the molecular formula C29H32FN3OS and a molecular weight of 489.66 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-[(2-fluorophenyl)sulfanylamino]phenyl]-piperidin-4-ylidenemethyl]benzamide.
| Compound Name | N,N-diethyl-4-[[2-[(2-fluorophenyl)sulfanylamino]phenyl]-piperidin-4-ylidenemethyl]benzamide |
|---|---|
| PubChem CID | 142966947 |
| Molecular Formula | C29H32FN3OS |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | N,N-diethyl-4-[[2-[(2-fluorophenyl)sulfanylamino]phenyl]-piperidin-4-ylidenemethyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCNCC2)c2ccccc2NSc2ccccc2F)cc1 |
| InChI | InChI=1S/C29H32FN3OS/c1-3-33(4-2)29(34)23-15-13-21(14-16-23)28(22-17-19-31-20-18-22)24-9-5-7-11-26(24)32-35-27-12-8-6-10-25(27)30/h5-16,31-32H,3-4,17-20H2,1-2H3 |
| InChIKey | NVGCWNZPRAWXFF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|