C24H28N2O2 — CID 23435917
N,N-diethyl-4-[(4-formylphenyl)-piperidin-4-ylidenemethyl]benzamide (PubChem CID 23435917) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N,N-diethyl-4-[(4-formylphenyl)-piperidin-4-ylidenemethyl]benzamide.
| Compound Name | N,N-diethyl-4-[(4-formylphenyl)-piperidin-4-ylidenemethyl]benzamide |
|---|---|
| PubChem CID | 23435917 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N,N-diethyl-4-[(4-formylphenyl)-piperidin-4-ylidenemethyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCNCC2)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-26(4-2)24(28)22-11-9-20(10-12-22)23(21-13-15-25-16-14-21)19-7-5-18(17-27)6-8-19/h5-12,17,25H,3-4,13-16H2,1-2H3 |
| InChIKey | QAHKDXJNXHXXCB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|