C23H30N4O — CID 142966960
N,N-diethyl-4-[(2-hydrazinylphenyl)-piperidin-4-ylidenemethyl]benzamide (PubChem CID 142966960) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N,N-diethyl-4-[(2-hydrazinylphenyl)-piperidin-4-ylidenemethyl]benzamide.
| Compound Name | N,N-diethyl-4-[(2-hydrazinylphenyl)-piperidin-4-ylidenemethyl]benzamide |
|---|---|
| PubChem CID | 142966960 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N,N-diethyl-4-[(2-hydrazinylphenyl)-piperidin-4-ylidenemethyl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCNCC2)c2ccccc2NN)cc1 |
| InChI | InChI=1S/C23H30N4O/c1-3-27(4-2)23(28)19-11-9-17(10-12-19)22(18-13-15-25-16-14-18)20-7-5-6-8-21(20)26-24/h5-12,25-26H,3-4,13-16,24H2,1-2H3 |
| InChIKey | BTMIRNYHGVROJB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|