C30H36N4O — CID 174490910
4-[[2-[N-(aminomethyl)anilino]phenyl]-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide (PubChem CID 174490910) has the molecular formula C30H36N4O and a molecular weight of 468.65 g/mol. Its IUPAC name is 4-[[2-[N-(aminomethyl)anilino]phenyl]-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-[N-(aminomethyl)anilino]phenyl]-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 174490910 |
| Molecular Formula | C30H36N4O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 4-[[2-[N-(aminomethyl)anilino]phenyl]-piperidin-4-ylidenemethyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(=C2CCNCC2)c2ccccc2N(CN)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N4O/c1-3-33(4-2)30(35)25-16-14-23(15-17-25)29(24-18-20-32-21-19-24)27-12-8-9-13-28(27)34(22-31)26-10-6-5-7-11-26/h5-17,32H,3-4,18-22,31H2,1-2H3 |
| InChIKey | GSNYHWNBCZNXMZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|