C7H13FN+ — CID 142969581
[(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium (PubChem CID 142969581) has the molecular formula C7H13FN+ and a molecular weight of 130.19 g/mol. Its IUPAC name is [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium.
| Compound Name | [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium |
|---|---|
| PubChem CID | 142969581 |
| Molecular Formula | C7H13FN+ |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium |
| SMILES | C[NH2+]/C=C\C=C(\C)CF |
| InChI | InChI=1S/C7H12FN/c1-7(6-8)4-3-5-9-2/h3-5,9H,6H2,1-2H3/p+1/b5-3-,7-4- |
| InChIKey | OJERLKLWODKHDP-XDYPTIOJSA-O |
| XLogP | 0.61 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|