About [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium
[(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium (PubChem CID 142969581) has the molecular formula C7H13FN+
and a molecular weight of 130.19 g/mol. Its IUPAC name is [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium.
Molecular Properties
| Compound Name | [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium |
| PubChem CID | 142969581 |
| Molecular Formula | C7H13FN+ |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium |
| SMILES | C[NH2+]/C=C\C=C(\C)CF |
| InChI | InChI=1S/C7H12FN/c1-7(6-8)4-3-5-9-2/h3-5,9H,6H2,1-2H3/p+1/b5-3-,7-4- |
| InChIKey | OJERLKLWODKHDP-XDYPTIOJSA-O |
| XLogP | 0.61 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium?
The IUPAC name of [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium (CID 142969581) is [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium.
What is the SMILES notation for [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium?
The canonical SMILES for [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium is C[NH2+]/C=C\C=C(\C)CF.
What is the InChIKey of [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium?
The InChIKey is OJERLKLWODKHDP-XDYPTIOJSA-O. The full InChI is InChI=1S/C7H12FN/c1-7(6-8)4-3-5-9-2/h3-5,9H,6H2,1-2H3/p+1/b5-3-,7-4-.
What are the key properties of [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium?
[(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium has a molecular weight of 130.19 g/mol, XLogP of 0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z,3Z)-5-fluoro-4-methylpenta-1,3-dienyl]-methylazanium is sourced from PubChem (CID 142969581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).