C16H17NO3S — CID 14297049
2-benzyl-5,6-dimethoxy-3H-1,2-benzothiazole 1-oxide (PubChem CID 14297049) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-benzyl-5,6-dimethoxy-3H-1,2-benzothiazole 1-oxide.
| Compound Name | 2-benzyl-5,6-dimethoxy-3H-1,2-benzothiazole 1-oxide |
|---|---|
| PubChem CID | 14297049 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-benzyl-5,6-dimethoxy-3H-1,2-benzothiazole 1-oxide |
| SMILES | COc1cc2c(cc1OC)S(=O)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C16H17NO3S/c1-19-14-8-13-11-17(10-12-6-4-3-5-7-12)21(18)16(13)9-15(14)20-2/h3-9H,10-11H2,1-2H3 |
| InChIKey | FSBWMDBGICKTHP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |