C13H18O3 — CID 142971047
(5E)-5-[(E)-3-hydroxypent-3-enylidene]-2,2-dimethyl-6-methylideneoxan-4-one (PubChem CID 142971047) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (5E)-5-[(E)-3-hydroxypent-3-enylidene]-2,2-dimethyl-6-methylideneoxan-4-one.
| Compound Name | (5E)-5-[(E)-3-hydroxypent-3-enylidene]-2,2-dimethyl-6-methylideneoxan-4-one |
|---|---|
| PubChem CID | 142971047 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (5E)-5-[(E)-3-hydroxypent-3-enylidene]-2,2-dimethyl-6-methylideneoxan-4-one |
| SMILES | C=C1OC(C)(C)CC(=O)/C1=C/C/C(O)=C\C |
| InChI | InChI=1S/C13H18O3/c1-5-10(14)6-7-11-9(2)16-13(3,4)8-12(11)15/h5,7,14H,2,6,8H2,1,3-4H3/b10-5+,11-7+ |
| InChIKey | ALEIRIBHYVWSAB-JRNXONEVSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|