C13H18O2 — CID 145474098
(5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one (PubChem CID 145474098) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one.
| Compound Name | (5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one |
|---|---|
| PubChem CID | 145474098 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one |
| SMILES | C=C/C=C1/C(=O)CC(C)(CC)O/C1=C/C |
| InChI | InChI=1S/C13H18O2/c1-5-8-10-11(14)9-13(4,7-3)15-12(10)6-2/h5-6,8H,1,7,9H2,2-4H3/b10-8-,12-6+ |
| InChIKey | KTAGGLNDGLGQOA-YNJFZHJKSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|