C15H24O2 — CID 145474097
ethane;(5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one (PubChem CID 145474097) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is ethane;(5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one.
| Compound Name | ethane;(5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one |
|---|---|
| PubChem CID | 145474097 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | ethane;(5E,6E)-2-ethyl-6-ethylidene-2-methyl-5-prop-2-enylideneoxan-4-one |
| SMILES | C=C/C=C1/C(=O)CC(C)(CC)O/C1=C/C.CC |
| InChI | InChI=1S/C13H18O2.C2H6/c1-5-8-10-11(14)9-13(4,7-3)15-12(10)6-2;1-2/h5-6,8H,1,7,9H2,2-4H3;1-2H3/b10-8-,12-6+; |
| InChIKey | IOZCYFLNLOGXCZ-HNUYFCEKSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|