C26H33NO2 — CID 142972180
ethane;6-methoxy-N-[(3E)-4-phenylbuta-1,3-dien-2-yl]-2-prop-1-en-2-yl-1-benzofuran-3-amine (PubChem CID 142972180) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is ethane;6-methoxy-N-[(3E)-4-phenylbuta-1,3-dien-2-yl]-2-prop-1-en-2-yl-1-benzofuran-3-amine.
| Compound Name | ethane;6-methoxy-N-[(3E)-4-phenylbuta-1,3-dien-2-yl]-2-prop-1-en-2-yl-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 142972180 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | ethane;6-methoxy-N-[(3E)-4-phenylbuta-1,3-dien-2-yl]-2-prop-1-en-2-yl-1-benzofuran-3-amine |
| SMILES | C=C(/C=C/c1ccccc1)Nc1c(C(=C)C)oc2cc(OC)ccc12.CC.CC |
| InChI | InChI=1S/C22H21NO2.2C2H6/c1-15(2)22-21(19-13-12-18(24-4)14-20(19)25-22)23-16(3)10-11-17-8-6-5-7-9-17;2*1-2/h5-14,23H,1,3H2,2,4H3;2*1-2H3/b11-10+;; |
| InChIKey | GCBNRFMCNHDABP-BGNBUWATSA-N |
| XLogP | 8.17 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|