C24H29F3N3O7P — CID 142972722
ethane;3-[[2-[3-(2-methylpropanoylamino)-2-oxo-1-pyridinyl]acetyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-phosphanylphenoxy)pentanoic acid (PubChem CID 142972722) has the molecular formula C24H29F3N3O7P and a molecular weight of 559.48 g/mol. Its IUPAC name is ethane;3-[[2-[3-(2-methylpropanoylamino)-2-oxo-1-pyridinyl]acetyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-phosphanylphenoxy)pentanoic acid.
| Compound Name | ethane;3-[[2-[3-(2-methylpropanoylamino)-2-oxo-1-pyridinyl]acetyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-phosphanylphenoxy)pentanoic acid |
|---|---|
| PubChem CID | 142972722 |
| Molecular Formula | C24H29F3N3O7P |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | ethane;3-[[2-[3-(2-methylpropanoylamino)-2-oxo-1-pyridinyl]acetyl]amino]-4-oxo-5-(2,3,6-trifluoro-5-phosphanylphenoxy)pentanoic acid |
| SMILES | CC.CC(C)C(=O)Nc1cccn(CC(=O)NC(CC(=O)O)C(=O)COc2c(F)c(F)cc(P)c2F)c1=O |
| InChI | InChI=1S/C22H23F3N3O7P.C2H6/c1-10(2)21(33)27-12-4-3-5-28(22(12)34)8-16(30)26-13(7-17(31)32)14(29)9-35-20-18(24)11(23)6-15(36)19(20)25;1-2/h3-6,10,13H,7-9,36H2,1-2H3,(H,26,30)(H,27,33)(H,31,32);1-2H3 |
| InChIKey | XKRCSQFQFLAVDN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|