C15H13F3N4O2 — CID 142975923
4-amino-2-[2-methyl-3-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 142975923) has the molecular formula C15H13F3N4O2 and a molecular weight of 338.29 g/mol. Its IUPAC name is 4-amino-2-[2-methyl-3-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 4-amino-2-[2-methyl-3-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 142975923 |
| Molecular Formula | C15H13F3N4O2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-amino-2-[2-methyl-3-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CN1OC(c2cc(N)ccc2O)=NC1c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N4O2/c1-22-13(12-10(15(16,17)18)3-2-6-20-12)21-14(24-22)9-7-8(19)4-5-11(9)23/h2-7,13,23H,19H2,1H3 |
| InChIKey | QTZSOGHGQIZPJE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|