C16H14BrF3N4O — CID 162580421
4-bromo-2-[2,4-dimethyl-5-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-triazol-3-yl]phenol (PubChem CID 162580421) has the molecular formula C16H14BrF3N4O and a molecular weight of 415.21 g/mol. Its IUPAC name is 4-bromo-2-[2,4-dimethyl-5-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-triazol-3-yl]phenol.
| Compound Name | 4-bromo-2-[2,4-dimethyl-5-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 162580421 |
| Molecular Formula | C16H14BrF3N4O |
| Molecular Weight | 415.21 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 4-bromo-2-[2,4-dimethyl-5-[3-(trifluoromethyl)-2-pyridinyl]-3H-1,2,4-triazol-3-yl]phenol |
| SMILES | CN1N=C(c2ncccc2C(F)(F)F)N(C)C1c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H14BrF3N4O/c1-23-14(13-11(16(18,19)20)4-3-7-21-13)22-24(2)15(23)10-8-9(17)5-6-12(10)25/h3-8,15,25H,1-2H3 |
| InChIKey | GWYBRMPZPMEFPJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|