C29H39N5O3Si- — CID 142977965
CID 142977965 (PubChem CID 142977965) has the molecular formula C29H39N5O3Si- and a molecular weight of 533.75 g/mol.
| Compound Name | CID 142977965 |
|---|---|
| PubChem CID | 142977965 |
| Molecular Formula | C29H39N5O3Si- |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-n2nc([Si-]3(C)CCCCC3)cc2NC(=O)Nc2ccc(OCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H39N5O3Si/c1-23-6-10-25(11-7-23)34-27(22-28(32-34)38(2)20-4-3-5-21-38)31-29(35)30-24-8-12-26(13-9-24)37-19-16-33-14-17-36-18-15-33/h6-13,22H,3-5,14-21H2,1-2H3,(H2,30,31,35)/q-1 |
| InChIKey | XQLCTGPTNIRWIA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|