C13H20FNO2S — CID 142978456
1-(3-fluorophenyl)-2-(3-hydroxysulfanylpropylamino)-2-methylpropan-1-ol (PubChem CID 142978456) has the molecular formula C13H20FNO2S and a molecular weight of 273.37 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(3-hydroxysulfanylpropylamino)-2-methylpropan-1-ol.
| Compound Name | 1-(3-fluorophenyl)-2-(3-hydroxysulfanylpropylamino)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 142978456 |
| Molecular Formula | C13H20FNO2S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(3-hydroxysulfanylpropylamino)-2-methylpropan-1-ol |
| SMILES | CC(C)(NCCCSO)C(O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H20FNO2S/c1-13(2,15-7-4-8-18-17)12(16)10-5-3-6-11(14)9-10/h3,5-6,9,12,15-17H,4,7-8H2,1-2H3 |
| InChIKey | ASQSCQAATKMTHA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|