C20H29Cl2N3O2 — CID 142979827
1-(2,3-dichlorophenyl)piperazine;3-hydroxy-1H-pyridin-2-one;pentane (PubChem CID 142979827) has the molecular formula C20H29Cl2N3O2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)piperazine;3-hydroxy-1H-pyridin-2-one;pentane.
| Compound Name | 1-(2,3-dichlorophenyl)piperazine;3-hydroxy-1H-pyridin-2-one;pentane |
|---|---|
| PubChem CID | 142979827 |
| Molecular Formula | C20H29Cl2N3O2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-(2,3-dichlorophenyl)piperazine;3-hydroxy-1H-pyridin-2-one;pentane |
| SMILES | CCCCC.Clc1cccc(N2CCNCC2)c1Cl.O=c1[nH]cccc1O |
| InChI | InChI=1S/C10H12Cl2N2.C5H5NO2.C5H12/c11-8-2-1-3-9(10(8)12)14-6-4-13-5-7-14;7-4-2-1-3-6-5(4)8;1-3-5-4-2/h1-3,13H,4-7H2;1-3,7H,(H,6,8);3-5H2,1-2H3 |
| InChIKey | PDXOCEHJNGIJSR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |