C10H18N2 — CID 142980191
[(3E)-4-cyclohexylbuta-1,3-dien-2-yl]hydrazine (PubChem CID 142980191) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]hydrazine.
| Compound Name | [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 142980191 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | [(3E)-4-cyclohexylbuta-1,3-dien-2-yl]hydrazine |
| SMILES | C=C(/C=C/C1CCCCC1)NN |
| InChI | InChI=1S/C10H18N2/c1-9(12-11)7-8-10-5-3-2-4-6-10/h7-8,10,12H,1-6,11H2/b8-7+ |
| InChIKey | NKEGVTNSVCAHDU-BQYQJAHWSA-N |
| XLogP | 2.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|