C12H20N2 — CID 143857596
3-(cyclohexylmethyl)-6-methyl-1,2-dihydropyridazine (PubChem CID 143857596) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-6-methyl-1,2-dihydropyridazine.
| Compound Name | 3-(cyclohexylmethyl)-6-methyl-1,2-dihydropyridazine |
|---|---|
| PubChem CID | 143857596 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-(cyclohexylmethyl)-6-methyl-1,2-dihydropyridazine |
| SMILES | CC1=CC=C(CC2CCCCC2)NN1 |
| InChI | InChI=1S/C12H20N2/c1-10-7-8-12(14-13-10)9-11-5-3-2-4-6-11/h7-8,11,13-14H,2-6,9H2,1H3 |
| InChIKey | YLGXCMQRRUSLSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |