C18H24N2 — CID 143912657
[4-[(6E)-2-[(E)-prop-1-enyl]-6-prop-2-enylidenecyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]hydrazine (PubChem CID 143912657) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is [4-[(6E)-2-[(E)-prop-1-enyl]-6-prop-2-enylidenecyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]hydrazine.
| Compound Name | [4-[(6E)-2-[(E)-prop-1-enyl]-6-prop-2-enylidenecyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]hydrazine |
|---|---|
| PubChem CID | 143912657 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [4-[(6E)-2-[(E)-prop-1-enyl]-6-prop-2-enylidenecyclohexen-1-yl]cyclohexa-1,3-dien-1-yl]hydrazine |
| SMILES | C=C/C=C1\CCCC(/C=C/C)=C1C1=CC=C(NN)CC1 |
| InChI | InChI=1S/C18H24N2/c1-3-6-14-8-5-9-15(7-4-2)18(14)16-10-12-17(20-19)13-11-16/h3-4,6-7,10,12,20H,1,5,8-9,11,13,19H2,2H3/b7-4+,14-6+ |
| InChIKey | VYLXCWYRDKXFKL-ZXDJEDQNSA-N |
| XLogP | 4.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|