C12H20N2 — CID 152587400
(1-cyclohexylcyclohexa-2,4-dien-1-yl)hydrazine (PubChem CID 152587400) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (1-cyclohexylcyclohexa-2,4-dien-1-yl)hydrazine.
| Compound Name | (1-cyclohexylcyclohexa-2,4-dien-1-yl)hydrazine |
|---|---|
| PubChem CID | 152587400 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (1-cyclohexylcyclohexa-2,4-dien-1-yl)hydrazine |
| SMILES | NNC1(C2CCCCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H20N2/c13-14-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h2,5-6,9,11,14H,1,3-4,7-8,10,13H2 |
| InChIKey | YUSZZKLWCIJVMK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|