C12H12F2N2O — CID 142983917
(1E)-2-[(2,6-difluorophenyl)methoxy]-1-(methylideneamino)buta-1,3-dien-1-amine (PubChem CID 142983917) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is (1E)-2-[(2,6-difluorophenyl)methoxy]-1-(methylideneamino)buta-1,3-dien-1-amine.
| Compound Name | (1E)-2-[(2,6-difluorophenyl)methoxy]-1-(methylideneamino)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142983917 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (1E)-2-[(2,6-difluorophenyl)methoxy]-1-(methylideneamino)buta-1,3-dien-1-amine |
| SMILES | C=C/C(OCc1c(F)cccc1F)=C(/N)N=C |
| InChI | InChI=1S/C12H12F2N2O/c1-3-11(12(15)16-2)17-7-8-9(13)5-4-6-10(8)14/h3-6H,1-2,7,15H2/b12-11+ |
| InChIKey | XRSCMGIWSKNLRJ-VAWYXSNFSA-N |
| XLogP | 2.50 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|