C6H8BrN — CID 142984206
(3Z,5E)-6-bromohexa-3,5-dien-2-imine (PubChem CID 142984206) has the molecular formula C6H8BrN and a molecular weight of 174.04 g/mol. Its IUPAC name is (3Z,5E)-6-bromohexa-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-6-bromohexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 142984206 |
| Molecular Formula | C6H8BrN |
| Molecular Weight | 174.04 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | (3Z,5E)-6-bromohexa-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C=C\Br |
| InChI | InChI=1S/C6H8BrN/c1-6(8)4-2-3-5-7/h2-5,8H,1H3/b4-2-,5-3+,8-6+ |
| InChIKey | LGDYTMMAHDTHAS-ZNSFGXPESA-N |
| XLogP | 2.49 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.04 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|