C15H26F2O — CID 142984266
4,4-difluoro-3-methyl-1-[(1R)-3-methylidenecyclopentyl]octan-3-ol (PubChem CID 142984266) has the molecular formula C15H26F2O and a molecular weight of 260.37 g/mol. Its IUPAC name is 4,4-difluoro-3-methyl-1-[(1R)-3-methylidenecyclopentyl]octan-3-ol.
| Compound Name | 4,4-difluoro-3-methyl-1-[(1R)-3-methylidenecyclopentyl]octan-3-ol |
|---|---|
| PubChem CID | 142984266 |
| Molecular Formula | C15H26F2O |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 4,4-difluoro-3-methyl-1-[(1R)-3-methylidenecyclopentyl]octan-3-ol |
| SMILES | C=C1CC[C@H](CCC(C)(O)C(F)(F)CCCC)C1 |
| InChI | InChI=1S/C15H26F2O/c1-4-5-9-15(16,17)14(3,18)10-8-13-7-6-12(2)11-13/h13,18H,2,4-11H2,1,3H3/t13-,14?/m1/s1 |
| InChIKey | AIRWHDUBWZDXEZ-KWCCSABGSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|