C17H17ClO — CID 142985393
5-[(Z)-4-chloro-2-phenylbut-1-enyl]cyclohepta-1,4,6-trien-1-ol (PubChem CID 142985393) has the molecular formula C17H17ClO and a molecular weight of 272.77 g/mol. Its IUPAC name is 5-[(Z)-4-chloro-2-phenylbut-1-enyl]cyclohepta-1,4,6-trien-1-ol.
| Compound Name | 5-[(Z)-4-chloro-2-phenylbut-1-enyl]cyclohepta-1,4,6-trien-1-ol |
|---|---|
| PubChem CID | 142985393 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-[(Z)-4-chloro-2-phenylbut-1-enyl]cyclohepta-1,4,6-trien-1-ol |
| SMILES | OC1=CCC=C(/C=C(/CCCl)c2ccccc2)C=C1 |
| InChI | InChI=1S/C17H17ClO/c18-12-11-16(15-6-2-1-3-7-15)13-14-5-4-8-17(19)10-9-14/h1-3,5-10,13,19H,4,11-12H2/b16-13- |
| InChIKey | GXADZONYVGBJOM-SSZFMOIBSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|