C27H35ClO5 — CID 142986318
tert-butyl 2-[4-[(E)-3-(4-chloro-2-methoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]propanoate;ethane (PubChem CID 142986318) has the molecular formula C27H35ClO5 and a molecular weight of 475.03 g/mol. Its IUPAC name is tert-butyl 2-[4-[(E)-3-(4-chloro-2-methoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]propanoate;ethane.
| Compound Name | tert-butyl 2-[4-[(E)-3-(4-chloro-2-methoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]propanoate;ethane |
|---|---|
| PubChem CID | 142986318 |
| Molecular Formula | C27H35ClO5 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | tert-butyl 2-[4-[(E)-3-(4-chloro-2-methoxyphenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]propanoate;ethane |
| SMILES | CC.COc1cc(Cl)ccc1C(=O)/C=C/c1cc(C)c(OC(C)C(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C25H29ClO5.C2H6/c1-15-12-18(8-11-21(27)20-10-9-19(26)14-22(20)29-7)13-16(2)23(15)30-17(3)24(28)31-25(4,5)6;1-2/h8-14,17H,1-7H3;1-2H3/b11-8+; |
| InChIKey | YDQSRKWXWPWNAC-YGCVIUNWSA-N |
| XLogP | 7.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|