C29H47N4O3+ — CID 142987916
cyclopropanecarboxamide;ethane;hydroxy-[(1Z,3Z)-6-[1-oxo-8-(3-phenylpropyl)-2,8-diazaspiro[4.5]decan-2-yl]hexa-1,3-dienyl]azanium (PubChem CID 142987916) has the molecular formula C29H47N4O3+ and a molecular weight of 499.72 g/mol. Its IUPAC name is cyclopropanecarboxamide;ethane;hydroxy-[(1Z,3Z)-6-[1-oxo-8-(3-phenylpropyl)-2,8-diazaspiro[4.5]decan-2-yl]hexa-1,3-dienyl]azanium.
| Compound Name | cyclopropanecarboxamide;ethane;hydroxy-[(1Z,3Z)-6-[1-oxo-8-(3-phenylpropyl)-2,8-diazaspiro[4.5]decan-2-yl]hexa-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 142987916 |
| Molecular Formula | C29H47N4O3+ |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.36 |
| IUPAC Name | cyclopropanecarboxamide;ethane;hydroxy-[(1Z,3Z)-6-[1-oxo-8-(3-phenylpropyl)-2,8-diazaspiro[4.5]decan-2-yl]hexa-1,3-dienyl]azanium |
| SMILES | CC.NC(=O)C1CC1.O=C1N(CC/C=C\C=C/[NH2+]O)CCC12CCN(CCCc1ccccc1)CC2 |
| InChI | InChI=1S/C23H33N3O2.C4H7NO.C2H6/c27-22-23(14-20-26(22)17-7-2-1-6-15-24-28)12-18-25(19-13-23)16-8-11-21-9-4-3-5-10-21;5-4(6)3-1-2-3;1-2/h1-6,9-10,15,24,28H,7-8,11-14,16-20H2;3H,1-2H2,(H2,5,6);1-2H3/p+1/b2-1-,15-6-;; |
| InChIKey | UIYPONYOWLOFLT-PCINKXFVSA-O |
| XLogP | 3.25 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|