C21H27ClN6O2 — CID 142988273
5-(4-chlorophenyl)-N-cyano-N'-(3-ethoxybutyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988273) has the molecular formula C21H27ClN6O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyano-N'-(3-ethoxybutyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyano-N'-(3-ethoxybutyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988273 |
| Molecular Formula | C21H27ClN6O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyano-N'-(3-ethoxybutyl)-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CCOC(C)CC/N=C(\NC#N)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C21H27ClN6O2/c1-3-30-15(2)10-11-24-21(25-14-23)28-13-18(27-12-4-5-19(27)29)20(26-28)16-6-8-17(22)9-7-16/h6-9,15,18H,3-5,10-13H2,1-2H3,(H,24,25) |
| InChIKey | VAZHKVLVNXXCPR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|