C19H22ClF3N6O2 — CID 127050658
N-[5-(4-chlorophenyl)-2-[N-cyano-N'-(4,4,4-trifluorobutyl)carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide (PubChem CID 127050658) has the molecular formula C19H22ClF3N6O2 and a molecular weight of 458.87 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-2-[N-cyano-N'-(4,4,4-trifluorobutyl)carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide.
| Compound Name | N-[5-(4-chlorophenyl)-2-[N-cyano-N'-(4,4,4-trifluorobutyl)carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide |
|---|---|
| PubChem CID | 127050658 |
| Molecular Formula | C19H22ClF3N6O2 |
| Molecular Weight | 458.87 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[5-(4-chlorophenyl)-2-[N-cyano-N'-(4,4,4-trifluorobutyl)carbamimidoyl]-3,4-dihydropyrazol-4-yl]-N-ethyl-2-hydroxyacetamide |
| SMILES | CCN(C(=O)CO)C1CN(/C(=N/CCCC(F)(F)F)NC#N)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClF3N6O2/c1-2-28(16(31)11-30)15-10-29(27-17(15)13-4-6-14(20)7-5-13)18(26-12-24)25-9-3-8-19(21,22)23/h4-7,15,30H,2-3,8-11H2,1H3,(H,25,26) |
| InChIKey | OLVJICCLAJDEDD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.87 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|