C19H20ClF3N6O2 — CID 142988436
5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988436) has the molecular formula C19H20ClF3N6O2 and a molecular weight of 456.86 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988436 |
| Molecular Formula | C19H20ClF3N6O2 |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyano-4-(2-oxopyrrolidin-1-yl)-N'-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CCOCC(F)(F)F)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C19H20ClF3N6O2/c20-14-5-3-13(4-6-14)17-15(28-8-1-2-16(28)30)10-29(27-17)18(26-12-24)25-7-9-31-11-19(21,22)23/h3-6,15H,1-2,7-11H2,(H,25,26) |
| InChIKey | XSQWSXUAKKRJSH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|