C24H22ClF3N6O — CID 142988391
N'-[2-(3-chlorophenyl)ethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988391) has the molecular formula C24H22ClF3N6O and a molecular weight of 502.93 g/mol. Its IUPAC name is N'-[2-(3-chlorophenyl)ethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N'-[2-(3-chlorophenyl)ethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988391 |
| Molecular Formula | C24H22ClF3N6O |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | N'-[2-(3-chlorophenyl)ethyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-5-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CCc1cccc(Cl)c1)N1CC(N2CCCC2=O)C(c2ccc(C(F)(F)F)cc2)=N1 |
| InChI | InChI=1S/C24H22ClF3N6O/c25-19-4-1-3-16(13-19)10-11-30-23(31-15-29)34-14-20(33-12-2-5-21(33)35)22(32-34)17-6-8-18(9-7-17)24(26,27)28/h1,3-4,6-9,13,20H,2,5,10-12,14H2,(H,30,31) |
| InChIKey | GVAOAQIWRIKFCH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|